C14H18Cl3N2O2+ — CID 6961260
[(1R)-1-benzamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 6961260) has the molecular formula C14H18Cl3N2O2+ and a molecular weight of 352.67 g/mol. Its IUPAC name is [(1R)-1-benzamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(1R)-1-benzamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 6961260 |
| Molecular Formula | C14H18Cl3N2O2+ |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [(1R)-1-benzamido-2,2,2-trichloroethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | O=C(N[C@H]([NH2+]C[C@H]1CCCO1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H17Cl3N2O2/c15-14(16,17)13(18-9-11-7-4-8-21-11)19-12(20)10-5-2-1-3-6-10/h1-3,5-6,11,13,18H,4,7-9H2,(H,19,20)/p+1/t11-,13+/m1/s1 |
| InChIKey | FDSUBHNXZLKPLY-YPMHNXCESA-O |
| XLogP | 1.86 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|