C12H16Cl3N2O2S+ — CID 7322720
[(2R)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]azanium (PubChem CID 7322720) has the molecular formula C12H16Cl3N2O2S+ and a molecular weight of 358.70 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]azanium.
| Compound Name | [(2R)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]azanium |
|---|---|
| PubChem CID | 7322720 |
| Molecular Formula | C12H16Cl3N2O2S+ |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-(thiophene-2-carbonylamino)ethyl]azanium |
| SMILES | O=C(N[C@H]([NH2+]C[C@H]1CCCO1)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C12H15Cl3N2O2S/c13-12(14,15)11(16-7-8-3-1-5-19-8)17-10(18)9-4-2-6-20-9/h2,4,6,8,11,16H,1,3,5,7H2,(H,17,18)/p+1/t8-,11+/m1/s1 |
| InChIKey | IIFFDZWFGUEOLB-KCJUWKMLSA-O |
| XLogP | 1.92 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|