C18H20Cl3N2O2+ — CID 3398838
oxolan-2-ylmethyl-[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]azanium (PubChem CID 3398838) has the molecular formula C18H20Cl3N2O2+ and a molecular weight of 402.73 g/mol. Its IUPAC name is oxolan-2-ylmethyl-[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]azanium.
| Compound Name | oxolan-2-ylmethyl-[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]azanium |
|---|---|
| PubChem CID | 3398838 |
| Molecular Formula | C18H20Cl3N2O2+ |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | oxolan-2-ylmethyl-[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]azanium |
| SMILES | O=C(NC([NH2+]CC1CCCO1)C(Cl)(Cl)Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H19Cl3N2O2/c19-18(20,21)17(22-11-13-7-4-10-25-13)23-16(24)15-9-3-6-12-5-1-2-8-14(12)15/h1-3,5-6,8-9,13,17,22H,4,7,10-11H2,(H,23,24)/p+1 |
| InChIKey | PDGDBECHNOBEQM-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|