C14H17Cl4N2O2+ — CID 6961281
[(2S)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]azanium (PubChem CID 6961281) has the molecular formula C14H17Cl4N2O2+ and a molecular weight of 387.11 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]azanium.
| Compound Name | [(2S)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 6961281 |
| Molecular Formula | C14H17Cl4N2O2+ |
| Molecular Weight | 387.11 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl-[(1R)-2,2,2-trichloro-1-[(3-chlorobenzoyl)amino]ethyl]azanium |
| SMILES | O=C(N[C@H]([NH2+]C[C@@H]1CCCO1)C(Cl)(Cl)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16Cl4N2O2/c15-10-4-1-3-9(7-10)12(21)20-13(14(16,17)18)19-8-11-5-2-6-22-11/h1,3-4,7,11,13,19H,2,5-6,8H2,(H,20,21)/p+1/t11-,13-/m0/s1 |
| InChIKey | WNICOZKZQYTYHJ-AAEUAGOBSA-O |
| XLogP | 2.51 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.11 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|