C15H20Cl3N2O2+ — CID 7031959
[(2S)-oxolan-2-yl]methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium (PubChem CID 7031959) has the molecular formula C15H20Cl3N2O2+ and a molecular weight of 366.70 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium.
| Compound Name | [(2S)-oxolan-2-yl]methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7031959 |
| Molecular Formula | C15H20Cl3N2O2+ |
| Molecular Weight | 366.70 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl-[(1S)-2,2,2-trichloro-1-[(4-methylbenzoyl)amino]ethyl]azanium |
| SMILES | Cc1ccc(C(=O)N[C@@H]([NH2+]C[C@@H]2CCCO2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H19Cl3N2O2/c1-10-4-6-11(7-5-10)13(21)20-14(15(16,17)18)19-9-12-3-2-8-22-12/h4-7,12,14,19H,2-3,8-9H2,1H3,(H,20,21)/p+1/t12-,14+/m0/s1 |
| InChIKey | OLSTVGRJXFTXEE-GXTWGEPZSA-O |
| XLogP | 2.16 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|