C20H25N2O2+ — CID 2453736
[(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl]-[[(2S)-oxolan-2-yl]methyl]azanium (PubChem CID 2453736) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl]-[[(2S)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl]-[[(2S)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 2453736 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl]-[[(2S)-oxolan-2-yl]methyl]azanium |
| SMILES | Cc1ccc(NC(=O)[C@@H]([NH2+]C[C@@H]2CCCO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-15-9-11-17(12-10-15)22-20(23)19(16-6-3-2-4-7-16)21-14-18-8-5-13-24-18/h2-4,6-7,9-12,18-19,21H,5,8,13-14H2,1H3,(H,22,23)/p+1/t18-,19-/m0/s1 |
| InChIKey | NTFKDVRIEMNYBT-OALUTQOASA-O |
| XLogP | 2.42 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |