C15H19Cl3N2O2 — CID 1099742
2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methylamino]ethyl]benzamide (PubChem CID 1099742) has the molecular formula C15H19Cl3N2O2 and a molecular weight of 365.69 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methylamino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 1099742 |
| Molecular Formula | C15H19Cl3N2O2 |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methylamino]ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](NC[C@@H]1CCCO1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H19Cl3N2O2/c1-10-5-2-3-7-12(10)13(21)20-14(15(16,17)18)19-9-11-6-4-8-22-11/h2-3,5,7,11,14,19H,4,6,8-9H2,1H3,(H,20,21)/t11-,14-/m0/s1 |
| InChIKey | FRJNADGQNLMKMU-FZMZJTMJSA-N |
| XLogP | 3.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|