C18H26N2O3 — CID 93144997
2-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-oxolan-2-yl]methylamino]butan-2-yl]benzamide (PubChem CID 93144997) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-oxolan-2-yl]methylamino]butan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-oxolan-2-yl]methylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 93144997 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-oxolan-2-yl]methylamino]butan-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)NC[C@H]1CCCO1)C(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-12(2)16(18(22)19-11-14-8-6-10-23-14)20-17(21)15-9-5-4-7-13(15)3/h4-5,7,9,12,14,16H,6,8,10-11H2,1-3H3,(H,19,22)(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | BLYTVNFKCAWBBL-ZBFHGGJFSA-N |
| XLogP | 2.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |