C19H19BrN2O4 — CID 25305379
(2R)-3-(4-bromophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2-(2-oxo-1-pyridinyl)propanamide (PubChem CID 25305379) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is (2R)-3-(4-bromophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | (2R)-3-(4-bromophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 25305379 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (2R)-3-(4-bromophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2-(2-oxo-1-pyridinyl)propanamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@@H](C(=O)c1ccc(Br)cc1)n1ccccc1=O |
| InChI | InChI=1S/C19H19BrN2O4/c20-14-8-6-13(7-9-14)18(24)17(22-10-2-1-5-16(22)23)19(25)21-12-15-4-3-11-26-15/h1-2,5-10,15,17H,3-4,11-12H2,(H,21,25)/t15-,17+/m0/s1 |
| InChIKey | FXJXOFBLDIFFGX-DOTOQJQBSA-N |
| XLogP | 2.33 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|