C19H18ClFN2O4 — CID 7317913
(2R)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]propanamide (PubChem CID 7317913) has the molecular formula C19H18ClFN2O4 and a molecular weight of 392.81 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 7317913 |
| Molecular Formula | C19H18ClFN2O4 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxo-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@@H](C(=O)c1ccc(F)cc1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C19H18ClFN2O4/c20-13-5-8-16(24)23(11-13)17(18(25)12-3-6-14(21)7-4-12)19(26)22-10-15-2-1-9-27-15/h3-8,11,15,17H,1-2,9-10H2,(H,22,26)/t15-,17+/m0/s1 |
| InChIKey | AGQXPTDSBPGGPE-DOTOQJQBSA-N |
| XLogP | 2.36 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|