C21H26ClFN3O3+ — CID 7233778
3-[[(2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxopropanoyl]amino]propyl-diethylazanium (PubChem CID 7233778) has the molecular formula C21H26ClFN3O3+ and a molecular weight of 422.91 g/mol. Its IUPAC name is 3-[[(2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxopropanoyl]amino]propyl-diethylazanium.
| Compound Name | 3-[[(2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxopropanoyl]amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7233778 |
| Molecular Formula | C21H26ClFN3O3+ |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[[(2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-3-oxopropanoyl]amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCNC(=O)[C@H](C(=O)c1ccc(F)cc1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C21H25ClFN3O3/c1-3-25(4-2)13-5-12-24-21(29)19(26-14-16(22)8-11-18(26)27)20(28)15-6-9-17(23)10-7-15/h6-11,14,19H,3-5,12-13H2,1-2H3,(H,24,29)/p+1/t19-/m0/s1 |
| InChIKey | FNDOYLQRKSIGAV-IBGZPJMESA-O |
| XLogP | 1.50 |
| TPSA | 72.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|