C19H18ClFN2O3 — CID 7317693
(2R)-2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-piperidin-1-ylpropane-1,3-dione (PubChem CID 7317693) has the molecular formula C19H18ClFN2O3 and a molecular weight of 376.81 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-piperidin-1-ylpropane-1,3-dione.
| Compound Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-piperidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 7317693 |
| Molecular Formula | C19H18ClFN2O3 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-piperidin-1-ylpropane-1,3-dione |
| SMILES | O=C(c1ccc(F)cc1)[C@H](C(=O)N1CCCCC1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C19H18ClFN2O3/c20-14-6-9-16(24)23(12-14)17(19(26)22-10-2-1-3-11-22)18(25)13-4-7-15(21)8-5-13/h4-9,12,17H,1-3,10-11H2/t17-/m1/s1 |
| InChIKey | MIDRGTSDVGZZFW-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|