C25H27ClFN3O4 — CID 3631498
2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-yl]propane-1,3-dione (PubChem CID 3631498) has the molecular formula C25H27ClFN3O4 and a molecular weight of 487.96 g/mol. Its IUPAC name is 2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-yl]propane-1,3-dione.
| Compound Name | 2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 3631498 |
| Molecular Formula | C25H27ClFN3O4 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-(5-chloro-2-oxo-1-pyridinyl)-1-(4-fluorophenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-yl]propane-1,3-dione |
| SMILES | O=C(c1ccc(F)cc1)C(C(=O)N1CCC(C(=O)N2CCCCC2)CC1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C25H27ClFN3O4/c26-19-6-9-21(31)30(16-19)22(23(32)17-4-7-20(27)8-5-17)25(34)29-14-10-18(11-15-29)24(33)28-12-2-1-3-13-28/h4-9,16,18,22H,1-3,10-15H2 |
| InChIKey | YYHMQQPWTSGPKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|