C26H31N3O4 — CID 41165207
(2R)-1-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-(2-oxo-1-pyridinyl)-3-phenylpropane-1,3-dione (PubChem CID 41165207) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (2R)-1-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-(2-oxo-1-pyridinyl)-3-phenylpropane-1,3-dione.
| Compound Name | (2R)-1-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-(2-oxo-1-pyridinyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 41165207 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (2R)-1-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-(2-oxo-1-pyridinyl)-3-phenylpropane-1,3-dione |
| SMILES | CC1CCN(C(=O)C2CCN(C(=O)[C@@H](C(=O)c3ccccc3)n3ccccc3=O)CC2)CC1 |
| InChI | InChI=1S/C26H31N3O4/c1-19-10-15-27(16-11-19)25(32)21-12-17-28(18-13-21)26(33)23(29-14-6-5-9-22(29)30)24(31)20-7-3-2-4-8-20/h2-9,14,19,21,23H,10-13,15-18H2,1H3/t23-/m1/s1 |
| InChIKey | ULDAONYYYRPCKV-HSZRJFAPSA-N |
| XLogP | 2.77 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|