C20H21N3O5 — CID 51361843
1-(4-methylpiperidin-1-yl)-3-(3-nitrophenyl)-2-(2-oxo-1-pyridinyl)propane-1,3-dione (PubChem CID 51361843) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-3-(3-nitrophenyl)-2-(2-oxo-1-pyridinyl)propane-1,3-dione.
| Compound Name | 1-(4-methylpiperidin-1-yl)-3-(3-nitrophenyl)-2-(2-oxo-1-pyridinyl)propane-1,3-dione |
|---|---|
| PubChem CID | 51361843 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-3-(3-nitrophenyl)-2-(2-oxo-1-pyridinyl)propane-1,3-dione |
| SMILES | CC1CCN(C(=O)C(C(=O)c2cccc([N+](=O)[O-])c2)n2ccccc2=O)CC1 |
| InChI | InChI=1S/C20H21N3O5/c1-14-8-11-21(12-9-14)20(26)18(22-10-3-2-7-17(22)24)19(25)15-5-4-6-16(13-15)23(27)28/h2-7,10,13-14,18H,8-9,11-12H2,1H3 |
| InChIKey | TWORBQGRQZPWKN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|