C22H17Cl2N3O5 — CID 3920071
N-[2-(2,4-dichlorophenyl)ethyl]-3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide (PubChem CID 3920071) has the molecular formula C22H17Cl2N3O5 and a molecular weight of 474.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 3920071 |
| Molecular Formula | C22H17Cl2N3O5 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)C(C(=O)c1cccc([N+](=O)[O-])c1)n1ccccc1=O |
| InChI | InChI=1S/C22H17Cl2N3O5/c23-16-8-7-14(18(24)13-16)9-10-25-22(30)20(26-11-2-1-6-19(26)28)21(29)15-4-3-5-17(12-15)27(31)32/h1-8,11-13,20H,9-10H2,(H,25,30) |
| InChIKey | WOMJYLHQBILWLF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|