C16H13Cl2NO3 — CID 157234645
4-(2,4-dichlorophenyl)-1-(3-nitrophenyl)butan-1-one (PubChem CID 157234645) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-1-(3-nitrophenyl)butan-1-one.
| Compound Name | 4-(2,4-dichlorophenyl)-1-(3-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 157234645 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-1-(3-nitrophenyl)butan-1-one |
| SMILES | O=C(CCCc1ccc(Cl)cc1Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13Cl2NO3/c17-13-8-7-11(15(18)10-13)3-2-6-16(20)12-4-1-5-14(9-12)19(21)22/h1,4-5,7-10H,2-3,6H2 |
| InChIKey | RVFGCNDROGGEFA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|