C15H11Cl2NO4 — CID 4165580
(3-nitrophenyl)methyl 2-(2,4-dichlorophenyl)acetate (PubChem CID 4165580) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-(2,4-dichlorophenyl)acetate.
| Compound Name | (3-nitrophenyl)methyl 2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 4165580 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | (3-nitrophenyl)methyl 2-(2,4-dichlorophenyl)acetate |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11Cl2NO4/c16-12-5-4-11(14(17)8-12)7-15(19)22-9-10-2-1-3-13(6-10)18(20)21/h1-6,8H,7,9H2 |
| InChIKey | GUYHZSPTVZXRKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|