C18H19NO7 — CID 5191268
(3-nitrophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 5191268) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (3-nitrophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 5191268 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (3-nitrophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCc2cccc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19NO7/c1-23-15-8-13(9-16(24-2)18(15)25-3)10-17(20)26-11-12-5-4-6-14(7-12)19(21)22/h4-9H,10-11H2,1-3H3 |
| InChIKey | UPRKPSAHQOGGEA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|