About 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate
2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate (PubChem CID 174412621) has the molecular formula C15H18ClNO4
and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate.
Molecular Properties
| Compound Name | 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate |
| PubChem CID | 174412621 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate |
| SMILES | CCC(=O)OCc1cccc([N+](=O)[O-])c1.ClC1CC2CC12 |
| InChI | InChI=1S/C10H11NO4.C5H7Cl/c1-2-10(12)15-7-8-4-3-5-9(6-8)11(13)14;6-5-2-3-1-4(3)5/h3-6H,2,7H2,1H3;3-5H,1-2H2 |
| InChIKey | VFNBLYAQGBFCJD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate?
The IUPAC name of 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate (CID 174412621) is 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate.
What is the SMILES notation for 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate?
The canonical SMILES for 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate is CCC(=O)OCc1cccc([N+](=O)[O-])c1.ClC1CC2CC12.
What is the InChIKey of 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate?
The InChIKey is VFNBLYAQGBFCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C5H7Cl/c1-2-10(12)15-7-8-4-3-5-9(6-8)11(13)14;6-5-2-3-1-4(3)5/h3-6H,2,7H2,1H3;3-5H,1-2H2.
What are the key properties of 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate?
2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate has a molecular weight of 311.77 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobicyclo[2.1.0]pentane;(3-nitrophenyl)methyl propanoate is sourced from PubChem (CID 174412621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).