C15H20N2O6S — CID 94434618
(3-nitrophenyl)methyl (3R)-1-ethylsulfonylpiperidine-3-carboxylate (PubChem CID 94434618) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is (3-nitrophenyl)methyl (3R)-1-ethylsulfonylpiperidine-3-carboxylate.
| Compound Name | (3-nitrophenyl)methyl (3R)-1-ethylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 94434618 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (3-nitrophenyl)methyl (3R)-1-ethylsulfonylpiperidine-3-carboxylate |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)OCc2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H20N2O6S/c1-2-24(21,22)16-8-4-6-13(10-16)15(18)23-11-12-5-3-7-14(9-12)17(19)20/h3,5,7,9,13H,2,4,6,8,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | NKVBZLJDULPRCH-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|