C21H20F2N2O6 — CID 55642251
(3-nitrophenyl)methyl 1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxylate (PubChem CID 55642251) has the molecular formula C21H20F2N2O6 and a molecular weight of 434.40 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxylate.
| Compound Name | (3-nitrophenyl)methyl 1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55642251 |
| Molecular Formula | C21H20F2N2O6 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (3-nitrophenyl)methyl 1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxylate |
| SMILES | O=C(OCc1cccc([N+](=O)[O-])c1)C1CCCN(C(=O)c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C21H20F2N2O6/c22-21(23)31-18-9-2-1-8-17(18)19(26)24-10-4-6-15(12-24)20(27)30-13-14-5-3-7-16(11-14)25(28)29/h1-3,5,7-9,11,15,21H,4,6,10,12-13H2 |
| InChIKey | QUNNAYCVENXHEU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|