C19H25NO6 — CID 91707913
1-O-(cyclohexylmethyl) 5-O-[(3-nitrophenyl)methyl] pentanedioate (PubChem CID 91707913) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-O-(cyclohexylmethyl) 5-O-[(3-nitrophenyl)methyl] pentanedioate.
| Compound Name | 1-O-(cyclohexylmethyl) 5-O-[(3-nitrophenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91707913 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-O-(cyclohexylmethyl) 5-O-[(3-nitrophenyl)methyl] pentanedioate |
| SMILES | O=C(CCCC(=O)OCC1CCCCC1)OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H25NO6/c21-18(25-13-15-6-2-1-3-7-15)10-5-11-19(22)26-14-16-8-4-9-17(12-16)20(23)24/h4,8-9,12,15H,1-3,5-7,10-11,13-14H2 |
| InChIKey | BGZGBVYTBNZDND-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|