C23H28O4 — CID 91717151
1-O-(cyclohexylmethyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate (PubChem CID 91717151) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-O-(cyclohexylmethyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate.
| Compound Name | 1-O-(cyclohexylmethyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate |
|---|---|
| PubChem CID | 91717151 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-O-(cyclohexylmethyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC1CCCCC1)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H28O4/c24-22(26-16-18-7-2-1-3-8-18)11-6-12-23(25)27-17-19-13-14-20-9-4-5-10-21(20)15-19/h4-5,9-10,13-15,18H,1-3,6-8,11-12,16-17H2 |
| InChIKey | SJVLQKRDLIZAIH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |