C22H17F3O4 — CID 91717224
1-O-(naphthalen-2-ylmethyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate (PubChem CID 91717224) has the molecular formula C22H17F3O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is 1-O-(naphthalen-2-ylmethyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate.
| Compound Name | 1-O-(naphthalen-2-ylmethyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate |
|---|---|
| PubChem CID | 91717224 |
| Molecular Formula | C22H17F3O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-O-(naphthalen-2-ylmethyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate |
| SMILES | O=C(CCCC(=O)Oc1ccc(F)c(F)c1F)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17F3O4/c23-17-10-11-18(22(25)21(17)24)29-20(27)7-3-6-19(26)28-13-14-8-9-15-4-1-2-5-16(15)12-14/h1-2,4-5,8-12H,3,6-7,13H2 |
| InChIKey | SYLLXGPNGWWROY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|