About 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate
5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate (PubChem CID 91717214) has the molecular formula C22H19FO4
and a molecular weight of 366.39 g/mol. Its IUPAC name is 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate.
Molecular Properties
| Compound Name | 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate |
| PubChem CID | 91717214 |
| Molecular Formula | C22H19FO4 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate |
| SMILES | O=C(CCCC(=O)Oc1cccc(F)c1)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H19FO4/c23-19-7-3-8-20(14-19)27-22(25)10-4-9-21(24)26-15-16-11-12-17-5-1-2-6-18(17)13-16/h1-3,5-8,11-14H,4,9-10,15H2 |
| InChIKey | LYXSNYGHZGLCPB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate?
The IUPAC name of 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate (CID 91717214) is 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate.
What is the SMILES notation for 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate?
The canonical SMILES for 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate is O=C(CCCC(=O)Oc1cccc(F)c1)OCc1ccc2ccccc2c1.
What is the InChIKey of 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate?
The InChIKey is LYXSNYGHZGLCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FO4/c23-19-7-3-8-20(14-19)27-22(25)10-4-9-21(24)26-15-16-11-12-17-5-1-2-6-18(17)13-16/h1-3,5-8,11-14H,4,9-10,15H2.
What are the key properties of 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate?
5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate has a molecular weight of 366.39 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(3-fluorophenyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate is sourced from PubChem (CID 91717214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).