C27H36BrNO3 — CID 139185470
naphthalen-2-ylmethyl 11-pyridin-1-ium-1-ylundecanoate;bromide;hydrate (PubChem CID 139185470) has the molecular formula C27H36BrNO3 and a molecular weight of 502.49 g/mol. Its IUPAC name is naphthalen-2-ylmethyl 11-pyridin-1-ium-1-ylundecanoate;bromide;hydrate.
| Compound Name | naphthalen-2-ylmethyl 11-pyridin-1-ium-1-ylundecanoate;bromide;hydrate |
|---|---|
| PubChem CID | 139185470 |
| Molecular Formula | C27H36BrNO3 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | naphthalen-2-ylmethyl 11-pyridin-1-ium-1-ylundecanoate;bromide;hydrate |
| SMILES | O.O=C(CCCCCCCCCC[n+]1ccccc1)OCc1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C27H34NO2.BrH.H2O/c29-27(30-23-24-17-18-25-14-9-10-15-26(25)22-24)16-8-5-3-1-2-4-6-11-19-28-20-12-7-13-21-28;;/h7,9-10,12-15,17-18,20-22H,1-6,8,11,16,19,23H2;1H;1H2/q+1;;/p-1 |
| InChIKey | HHPPKWODYXJVHN-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|