C24H31ClO4 — CID 91717152
1-O-(8-chlorooctyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate (PubChem CID 91717152) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is 1-O-(8-chlorooctyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate.
| Compound Name | 1-O-(8-chlorooctyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate |
|---|---|
| PubChem CID | 91717152 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-O-(8-chlorooctyl) 5-O-(naphthalen-2-ylmethyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCc1ccc2ccccc2c1)OCCCCCCCCCl |
| InChI | InChI=1S/C24H31ClO4/c25-16-7-3-1-2-4-8-17-28-23(26)12-9-13-24(27)29-19-20-14-15-21-10-5-6-11-22(21)18-20/h5-6,10-11,14-15,18H,1-4,7-9,12-13,16-17,19H2 |
| InChIKey | OOXSBHDRRSJWKD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|