C17H16Cl2O4 — CID 91717334
4-O-(2,2-dichloroethyl) 1-O-(naphthalen-2-ylmethyl) butanedioate (PubChem CID 91717334) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is 4-O-(2,2-dichloroethyl) 1-O-(naphthalen-2-ylmethyl) butanedioate.
| Compound Name | 4-O-(2,2-dichloroethyl) 1-O-(naphthalen-2-ylmethyl) butanedioate |
|---|---|
| PubChem CID | 91717334 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-O-(2,2-dichloroethyl) 1-O-(naphthalen-2-ylmethyl) butanedioate |
| SMILES | O=C(CCC(=O)OCC(Cl)Cl)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H16Cl2O4/c18-15(19)11-23-17(21)8-7-16(20)22-10-12-5-6-13-3-1-2-4-14(13)9-12/h1-6,9,15H,7-8,10-11H2 |
| InChIKey | IRNAXKBUXAHRGJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|