C20H24O4 — CID 91717144
5-O-(2-methylpropyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate (PubChem CID 91717144) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-O-(2-methylpropyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate.
| Compound Name | 5-O-(2-methylpropyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate |
|---|---|
| PubChem CID | 91717144 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-O-(2-methylpropyl) 1-O-(naphthalen-2-ylmethyl) pentanedioate |
| SMILES | CC(C)COC(=O)CCCC(=O)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24O4/c1-15(2)13-23-19(21)8-5-9-20(22)24-14-16-10-11-17-6-3-4-7-18(17)12-16/h3-4,6-7,10-12,15H,5,8-9,13-14H2,1-2H3 |
| InChIKey | XEAJYTJFIKOCBQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |