About (3-fluorophenyl) 6-chlorohexanoate
(3-fluorophenyl) 6-chlorohexanoate (PubChem CID 91714533) has the molecular formula C12H14ClFO2
and a molecular weight of 244.69 g/mol. Its IUPAC name is (3-fluorophenyl) 6-chlorohexanoate.
Molecular Properties
| Compound Name | (3-fluorophenyl) 6-chlorohexanoate |
| PubChem CID | 91714533 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3-fluorophenyl) 6-chlorohexanoate |
| SMILES | O=C(CCCCCCl)Oc1cccc(F)c1 |
| InChI | InChI=1S/C12H14ClFO2/c13-8-3-1-2-7-12(15)16-11-6-4-5-10(14)9-11/h4-6,9H,1-3,7-8H2 |
| InChIKey | ZBCZVXRCUKNLJO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) 6-chlorohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) 6-chlorohexanoate?
The IUPAC name of (3-fluorophenyl) 6-chlorohexanoate (CID 91714533) is (3-fluorophenyl) 6-chlorohexanoate.
What is the SMILES notation for (3-fluorophenyl) 6-chlorohexanoate?
The canonical SMILES for (3-fluorophenyl) 6-chlorohexanoate is O=C(CCCCCCl)Oc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl) 6-chlorohexanoate?
The InChIKey is ZBCZVXRCUKNLJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFO2/c13-8-3-1-2-7-12(15)16-11-6-4-5-10(14)9-11/h4-6,9H,1-3,7-8H2.
What are the key properties of (3-fluorophenyl) 6-chlorohexanoate?
(3-fluorophenyl) 6-chlorohexanoate has a molecular weight of 244.69 g/mol, XLogP of 3.53, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) 6-chlorohexanoate is sourced from PubChem (CID 91714533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).