About [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate
[3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate (PubChem CID 46863601) has the molecular formula C14H16Cl2O4
and a molecular weight of 319.18 g/mol. Its IUPAC name is [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate.
Molecular Properties
| Compound Name | [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate |
| PubChem CID | 46863601 |
| Molecular Formula | C14H16Cl2O4 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate |
| SMILES | O=C(CCCCl)Oc1cccc(OC(=O)CCCCl)c1 |
| InChI | InChI=1S/C14H16Cl2O4/c15-8-2-6-13(17)19-11-4-1-5-12(10-11)20-14(18)7-3-9-16/h1,4-5,10H,2-3,6-9H2 |
| InChIKey | AFGBJAIQNWZSCH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate?
The IUPAC name of [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate (CID 46863601) is [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate.
What is the SMILES notation for [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate?
The canonical SMILES for [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate is O=C(CCCCl)Oc1cccc(OC(=O)CCCCl)c1.
What is the InChIKey of [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate?
The InChIKey is AFGBJAIQNWZSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2O4/c15-8-2-6-13(17)19-11-4-1-5-12(10-11)20-14(18)7-3-9-16/h1,4-5,10H,2-3,6-9H2.
What are the key properties of [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate?
[3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate has a molecular weight of 319.18 g/mol, XLogP of 3.54, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorobutanoyloxy)phenyl] 4-chlorobutanoate is sourced from PubChem (CID 46863601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).