About (3-chlorophenyl) 5-hydroxypentanoate
(3-chlorophenyl) 5-hydroxypentanoate (PubChem CID 174546388) has the molecular formula C11H13ClO3
and a molecular weight of 228.68 g/mol. Its IUPAC name is (3-chlorophenyl) 5-hydroxypentanoate.
Molecular Properties
| Compound Name | (3-chlorophenyl) 5-hydroxypentanoate |
| PubChem CID | 174546388 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (3-chlorophenyl) 5-hydroxypentanoate |
| SMILES | O=C(CCCCO)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClO3/c12-9-4-3-5-10(8-9)15-11(14)6-1-2-7-13/h3-5,8,13H,1-2,6-7H2 |
| InChIKey | DYDQQXPRCADKPJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) 5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) 5-hydroxypentanoate?
The IUPAC name of (3-chlorophenyl) 5-hydroxypentanoate (CID 174546388) is (3-chlorophenyl) 5-hydroxypentanoate.
What is the SMILES notation for (3-chlorophenyl) 5-hydroxypentanoate?
The canonical SMILES for (3-chlorophenyl) 5-hydroxypentanoate is O=C(CCCCO)Oc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl) 5-hydroxypentanoate?
The InChIKey is DYDQQXPRCADKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3/c12-9-4-3-5-10(8-9)15-11(14)6-1-2-7-13/h3-5,8,13H,1-2,6-7H2.
What are the key properties of (3-chlorophenyl) 5-hydroxypentanoate?
(3-chlorophenyl) 5-hydroxypentanoate has a molecular weight of 228.68 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) 5-hydroxypentanoate is sourced from PubChem (CID 174546388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).