C17H12ClF3O4 — CID 91736060
1-O-(3-chlorophenyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate (PubChem CID 91736060) has the molecular formula C17H12ClF3O4 and a molecular weight of 372.73 g/mol. Its IUPAC name is 1-O-(3-chlorophenyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate.
| Compound Name | 1-O-(3-chlorophenyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate |
|---|---|
| PubChem CID | 91736060 |
| Molecular Formula | C17H12ClF3O4 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-O-(3-chlorophenyl) 5-O-(2,3,4-trifluorophenyl) pentanedioate |
| SMILES | O=C(CCCC(=O)Oc1ccc(F)c(F)c1F)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H12ClF3O4/c18-10-3-1-4-11(9-10)24-14(22)5-2-6-15(23)25-13-8-7-12(19)16(20)17(13)21/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | CIDURGJEPFTBGM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|