C16H9ClF4O4 — CID 91736678
4-O-(2-chloro-6-fluorophenyl) 1-O-(2,3,4-trifluorophenyl) butanedioate (PubChem CID 91736678) has the molecular formula C16H9ClF4O4 and a molecular weight of 376.69 g/mol. Its IUPAC name is 4-O-(2-chloro-6-fluorophenyl) 1-O-(2,3,4-trifluorophenyl) butanedioate.
| Compound Name | 4-O-(2-chloro-6-fluorophenyl) 1-O-(2,3,4-trifluorophenyl) butanedioate |
|---|---|
| PubChem CID | 91736678 |
| Molecular Formula | C16H9ClF4O4 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 4-O-(2-chloro-6-fluorophenyl) 1-O-(2,3,4-trifluorophenyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(F)cccc1Cl)Oc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H9ClF4O4/c17-8-2-1-3-10(19)16(8)25-13(23)7-6-12(22)24-11-5-4-9(18)14(20)15(11)21/h1-5H,6-7H2 |
| InChIKey | YOGWCONZQFPBAB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|