C18H24ClFO4 — CID 91738017
1-O-(2-chloro-6-fluorophenyl) 5-O-(2,4-dimethylpentan-3-yl) pentanedioate (PubChem CID 91738017) has the molecular formula C18H24ClFO4 and a molecular weight of 358.84 g/mol. Its IUPAC name is 1-O-(2-chloro-6-fluorophenyl) 5-O-(2,4-dimethylpentan-3-yl) pentanedioate.
| Compound Name | 1-O-(2-chloro-6-fluorophenyl) 5-O-(2,4-dimethylpentan-3-yl) pentanedioate |
|---|---|
| PubChem CID | 91738017 |
| Molecular Formula | C18H24ClFO4 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-O-(2-chloro-6-fluorophenyl) 5-O-(2,4-dimethylpentan-3-yl) pentanedioate |
| SMILES | CC(C)C(OC(=O)CCCC(=O)Oc1c(F)cccc1Cl)C(C)C |
| InChI | InChI=1S/C18H24ClFO4/c1-11(2)17(12(3)4)23-15(21)9-6-10-16(22)24-18-13(19)7-5-8-14(18)20/h5,7-8,11-12,17H,6,9-10H2,1-4H3 |
| InChIKey | LANLXQHAKBVLPL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|