C13H11ClF4O4 — CID 91732359
1-O-(2-chloro-6-fluorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91732359) has the molecular formula C13H11ClF4O4 and a molecular weight of 342.67 g/mol. Its IUPAC name is 1-O-(2-chloro-6-fluorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
| Compound Name | 1-O-(2-chloro-6-fluorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 91732359 |
| Molecular Formula | C13H11ClF4O4 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-O-(2-chloro-6-fluorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | CC(OC(=O)CCC(=O)Oc1c(F)cccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C13H11ClF4O4/c1-7(13(16,17)18)21-10(19)5-6-11(20)22-12-8(14)3-2-4-9(12)15/h2-4,7H,5-6H2,1H3 |
| InChIKey | TYKLXAZAHIYTFJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|