About [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate
[3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate (PubChem CID 90031619) has the molecular formula C16H21ClO4
and a molecular weight of 312.79 g/mol. Its IUPAC name is [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
| PubChem CID | 90031619 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1cccc(Cl)c1OC(=O)CC(C)C |
| InChI | InChI=1S/C16H21ClO4/c1-10(2)8-14(18)20-13-7-5-6-12(17)16(13)21-15(19)9-11(3)4/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | ZVIKYDPRIRFJMP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate?
The IUPAC name of [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate (CID 90031619) is [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate.
What is the SMILES notation for [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate?
The canonical SMILES for [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate is CC(C)CC(=O)Oc1cccc(Cl)c1OC(=O)CC(C)C.
What is the InChIKey of [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate?
The InChIKey is ZVIKYDPRIRFJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClO4/c1-10(2)8-14(18)20-13-7-5-6-12(17)16(13)21-15(19)9-11(3)4/h5-7,10-11H,8-9H2,1-4H3.
What are the key properties of [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate?
[3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate has a molecular weight of 312.79 g/mol, XLogP of 4.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate is sourced from PubChem (CID 90031619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).