C13H16Cl2O3 — CID 78872669
(2,6-dichlorophenyl) 3-(2-methylpropoxy)propanoate (PubChem CID 78872669) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 3-(2-methylpropoxy)propanoate.
| Compound Name | (2,6-dichlorophenyl) 3-(2-methylpropoxy)propanoate |
|---|---|
| PubChem CID | 78872669 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (2,6-dichlorophenyl) 3-(2-methylpropoxy)propanoate |
| SMILES | CC(C)COCCC(=O)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O3/c1-9(2)8-17-7-6-12(16)18-13-10(14)4-3-5-11(13)15/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | WEJWAHASCOKWRY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|