About (2,6-dichlorophenyl) 3-cyanopropanoate
(2,6-dichlorophenyl) 3-cyanopropanoate (PubChem CID 82117975) has the molecular formula C10H7Cl2NO2
and a molecular weight of 244.08 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 3-cyanopropanoate.
Molecular Properties
| Compound Name | (2,6-dichlorophenyl) 3-cyanopropanoate |
| PubChem CID | 82117975 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | (2,6-dichlorophenyl) 3-cyanopropanoate |
| SMILES | N#CCCC(=O)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H7Cl2NO2/c11-7-3-1-4-8(12)10(7)15-9(14)5-2-6-13/h1,3-4H,2,5H2 |
| InChIKey | AQJJOYQQQRPYAS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dichlorophenyl) 3-cyanopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dichlorophenyl) 3-cyanopropanoate?
The IUPAC name of (2,6-dichlorophenyl) 3-cyanopropanoate (CID 82117975) is (2,6-dichlorophenyl) 3-cyanopropanoate.
What is the SMILES notation for (2,6-dichlorophenyl) 3-cyanopropanoate?
The canonical SMILES for (2,6-dichlorophenyl) 3-cyanopropanoate is N#CCCC(=O)Oc1c(Cl)cccc1Cl.
What is the InChIKey of (2,6-dichlorophenyl) 3-cyanopropanoate?
The InChIKey is AQJJOYQQQRPYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO2/c11-7-3-1-4-8(12)10(7)15-9(14)5-2-6-13/h1,3-4H,2,5H2.
What are the key properties of (2,6-dichlorophenyl) 3-cyanopropanoate?
(2,6-dichlorophenyl) 3-cyanopropanoate has a molecular weight of 244.08 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichlorophenyl) 3-cyanopropanoate is sourced from PubChem (CID 82117975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).