C11H10Cl2N2O2 — CID 46568862
N-(2-cyanoethyl)-2-(2,6-dichlorophenoxy)acetamide (PubChem CID 46568862) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,6-dichlorophenoxy)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,6-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 46568862 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,6-dichlorophenoxy)acetamide |
| SMILES | N#CCCNC(=O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-8-3-1-4-9(13)11(8)17-7-10(16)15-6-2-5-14/h1,3-4H,2,6-7H2,(H,15,16) |
| InChIKey | KPTVCMAOQHEMSI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|