C14H19N3O3 — CID 60879269
2-[2-(aminomethyl)-6-ethoxyphenoxy]-N-(2-cyanoethyl)acetamide (PubChem CID 60879269) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-ethoxyphenoxy]-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-[2-(aminomethyl)-6-ethoxyphenoxy]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 60879269 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[2-(aminomethyl)-6-ethoxyphenoxy]-N-(2-cyanoethyl)acetamide |
| SMILES | CCOc1cccc(CN)c1OCC(=O)NCCC#N |
| InChI | InChI=1S/C14H19N3O3/c1-2-19-12-6-3-5-11(9-16)14(12)20-10-13(18)17-8-4-7-15/h3,5-6H,2,4,8-10,16H2,1H3,(H,17,18) |
| InChIKey | BETVFABNRRBJRU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|