C22H26N2O5 — CID 20984771
2-cyano-N-[2-[2-[2-(2-ethoxyphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide (PubChem CID 20984771) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-cyano-N-[2-[2-[2-(2-ethoxyphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[2-[2-(2-ethoxyphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 20984771 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-cyano-N-[2-[2-[2-(2-ethoxyphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide |
| SMILES | CCOc1ccccc1OCCOc1c(CCNC(=O)CC#N)cccc1OC |
| InChI | InChI=1S/C22H26N2O5/c1-3-27-18-8-4-5-9-19(18)28-15-16-29-22-17(7-6-10-20(22)26-2)12-14-24-21(25)11-13-23/h4-10H,3,11-12,14-16H2,1-2H3,(H,24,25) |
| InChIKey | DEQDWOPAPBGVKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|