C14H17Cl2N3O2 — CID 60907526
2-[2-(2-aminopropyl)-4,6-dichlorophenoxy]-N-(2-cyanoethyl)acetamide (PubChem CID 60907526) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 2-[2-(2-aminopropyl)-4,6-dichlorophenoxy]-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-[2-(2-aminopropyl)-4,6-dichlorophenoxy]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 60907526 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[2-(2-aminopropyl)-4,6-dichlorophenoxy]-N-(2-cyanoethyl)acetamide |
| SMILES | CC(N)Cc1cc(Cl)cc(Cl)c1OCC(=O)NCCC#N |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-9(18)5-10-6-11(15)7-12(16)14(10)21-8-13(20)19-4-2-3-17/h6-7,9H,2,4-5,8,18H2,1H3,(H,19,20) |
| InChIKey | SPESXNHHWAWSND-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|