C14H17Cl2N3O2 — CID 60888684
N-(cyanomethyl)-2-[2,4-dichloro-6-(propylaminomethyl)phenoxy]acetamide (PubChem CID 60888684) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[2,4-dichloro-6-(propylaminomethyl)phenoxy]acetamide.
| Compound Name | N-(cyanomethyl)-2-[2,4-dichloro-6-(propylaminomethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 60888684 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(cyanomethyl)-2-[2,4-dichloro-6-(propylaminomethyl)phenoxy]acetamide |
| SMILES | CCCNCc1cc(Cl)cc(Cl)c1OCC(=O)NCC#N |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-2-4-18-8-10-6-11(15)7-12(16)14(10)21-9-13(20)19-5-3-17/h6-7,18H,2,4-5,8-9H2,1H3,(H,19,20) |
| InChIKey | MXJPHQVHEVWCHH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|