C11H13Cl2NO3 — CID 43516177
2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-ethylacetamide (PubChem CID 43516177) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-ethylacetamide.
| Compound Name | 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 43516177 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1c(Cl)cc(Cl)cc1CO |
| InChI | InChI=1S/C11H13Cl2NO3/c1-2-14-10(16)6-17-11-7(5-15)3-8(12)4-9(11)13/h3-4,15H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | AVVVIPMZCNFOCB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |