C13H12Cl3FO4 — CID 91709321
5-O-(2-chloro-6-fluorophenyl) 1-O-(2,2-dichloroethyl) pentanedioate (PubChem CID 91709321) has the molecular formula C13H12Cl3FO4 and a molecular weight of 357.59 g/mol. Its IUPAC name is 5-O-(2-chloro-6-fluorophenyl) 1-O-(2,2-dichloroethyl) pentanedioate.
| Compound Name | 5-O-(2-chloro-6-fluorophenyl) 1-O-(2,2-dichloroethyl) pentanedioate |
|---|---|
| PubChem CID | 91709321 |
| Molecular Formula | C13H12Cl3FO4 |
| Molecular Weight | 357.59 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 5-O-(2-chloro-6-fluorophenyl) 1-O-(2,2-dichloroethyl) pentanedioate |
| SMILES | O=C(CCCC(=O)Oc1c(F)cccc1Cl)OCC(Cl)Cl |
| InChI | InChI=1S/C13H12Cl3FO4/c14-8-3-1-4-9(17)13(8)21-12(19)6-2-5-11(18)20-7-10(15)16/h1,3-4,10H,2,5-7H2 |
| InChIKey | QNWGBIJXOYWTRX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|