C12H9Cl5O4 — CID 91703008
1-O-(2,2-dichloroethyl) 4-O-(2,4,6-trichlorophenyl) butanedioate (PubChem CID 91703008) has the molecular formula C12H9Cl5O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-O-(2,2-dichloroethyl) 4-O-(2,4,6-trichlorophenyl) butanedioate.
| Compound Name | 1-O-(2,2-dichloroethyl) 4-O-(2,4,6-trichlorophenyl) butanedioate |
|---|---|
| PubChem CID | 91703008 |
| Molecular Formula | C12H9Cl5O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 1-O-(2,2-dichloroethyl) 4-O-(2,4,6-trichlorophenyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(Cl)cc(Cl)cc1Cl)OCC(Cl)Cl |
| InChI | InChI=1S/C12H9Cl5O4/c13-6-3-7(14)12(8(15)4-6)21-11(19)2-1-10(18)20-5-9(16)17/h3-4,9H,1-2,5H2 |
| InChIKey | HXCWOHWTKOYSSS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|