C16H17Cl3O4 — CID 91698255
1-O-[(Z)-hex-2-enyl] 4-O-(2,4,6-trichlorophenyl) butanedioate (PubChem CID 91698255) has the molecular formula C16H17Cl3O4 and a molecular weight of 379.67 g/mol. Its IUPAC name is 1-O-[(Z)-hex-2-enyl] 4-O-(2,4,6-trichlorophenyl) butanedioate.
| Compound Name | 1-O-[(Z)-hex-2-enyl] 4-O-(2,4,6-trichlorophenyl) butanedioate |
|---|---|
| PubChem CID | 91698255 |
| Molecular Formula | C16H17Cl3O4 |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-O-[(Z)-hex-2-enyl] 4-O-(2,4,6-trichlorophenyl) butanedioate |
| SMILES | CCC/C=C\COC(=O)CCC(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl3O4/c1-2-3-4-5-8-22-14(20)6-7-15(21)23-16-12(18)9-11(17)10-13(16)19/h4-5,9-10H,2-3,6-8H2,1H3/b5-4- |
| InChIKey | OBUDFYDUUNZUJI-PLNGDYQASA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|