C24H14F10O8 — CID 123677913
1-O-[4-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butanoyl]oxybut-2-enyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate (PubChem CID 123677913) has the molecular formula C24H14F10O8 and a molecular weight of 620.35 g/mol. Its IUPAC name is 1-O-[4-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butanoyl]oxybut-2-enyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate.
| Compound Name | 1-O-[4-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butanoyl]oxybut-2-enyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate |
|---|---|
| PubChem CID | 123677913 |
| Molecular Formula | C24H14F10O8 |
| Molecular Weight | 620.35 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 1-O-[4-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butanoyl]oxybut-2-enyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCC=CCOC(=O)CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H14F10O8/c25-13-15(27)19(31)23(20(32)16(13)28)41-11(37)5-3-9(35)39-7-1-2-8-40-10(36)4-6-12(38)42-24-21(33)17(29)14(26)18(30)22(24)34/h1-2H,3-8H2 |
| InChIKey | YKXLMNPAKUBOIA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|